C30H42O7 — CID 11733998
(2S,4S,5S)-4-[(2S,4R)-3-methoxy-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]pentan-2-yl]-2-(4-methoxyphenyl)-5-methyl-1,3-dioxane (PubChem CID 11733998) has the molecular formula C30H42O7 and a molecular weight of 514.66 g/mol. Its IUPAC name is (2S,4S,5S)-4-[(2S,4R)-3-methoxy-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]pentan-2-yl]-2-(4-methoxyphenyl)-5-methyl-1,3-dioxane.
| Compound Name | (2S,4S,5S)-4-[(2S,4R)-3-methoxy-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]pentan-2-yl]-2-(4-methoxyphenyl)-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 11733998 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | (2S,4S,5S)-4-[(2S,4R)-3-methoxy-4-[(2R,4R,5R)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]pentan-2-yl]-2-(4-methoxyphenyl)-5-methyl-1,3-dioxane |
| SMILES | COc1ccc([C@@H]2OC[C@@H](C)[C@H]([C@H](C)C(OC)[C@H](C)[C@H]3O[C@@H](c4ccc(OC)cc4)OC[C@@H]3C)O2)cc1 |
| InChI | InChI=1S/C30H42O7/c1-18-16-34-29(22-8-12-24(31-5)13-9-22)36-26(18)20(3)28(33-7)21(4)27-19(2)17-35-30(37-27)23-10-14-25(32-6)15-11-23/h8-15,18-21,26-30H,16-17H2,1-7H3/t18-,19+,20+,21-,26-,27+,28?,29-,30+ |
| InChIKey | GPFUVEKLLXBJGF-NNUUSTSSSA-N |
| XLogP | 5.79 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |