C33H36O3P+ — CID 101220093
[(2R)-2-[(4R,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propyl]-triphenylphosphanium (PubChem CID 101220093) has the molecular formula C33H36O3P+ and a molecular weight of 511.62 g/mol. Its IUPAC name is [(2R)-2-[(4R,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propyl]-triphenylphosphanium.
| Compound Name | [(2R)-2-[(4R,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 101220093 |
| Molecular Formula | C33H36O3P+ |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | [(2R)-2-[(4R,5S)-2-(4-methoxyphenyl)-5-methyl-1,3-dioxan-4-yl]propyl]-triphenylphosphanium |
| SMILES | COc1ccc(C2OC[C@H](C)[C@H]([C@@H](C)C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C33H36O3P/c1-25-23-35-33(27-19-21-28(34-3)22-20-27)36-32(25)26(2)24-37(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-22,25-26,32-33H,23-24H2,1-3H3/q+1/t25-,26-,32+,33?/m0/s1 |
| InChIKey | BRVUQWUORXGFPY-UMWNRURUSA-N |
| XLogP | 6.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|