C29H31NO6 — CID 11038287
(1R,2R,7S,9S)-8-benzyl-4,12-bis(4-methoxyphenyl)-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane (PubChem CID 11038287) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is (1R,2R,7S,9S)-8-benzyl-4,12-bis(4-methoxyphenyl)-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane.
| Compound Name | (1R,2R,7S,9S)-8-benzyl-4,12-bis(4-methoxyphenyl)-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane |
|---|---|
| PubChem CID | 11038287 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (1R,2R,7S,9S)-8-benzyl-4,12-bis(4-methoxyphenyl)-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane |
| SMILES | COc1ccc(C2OC[C@H]3[C@@H](O2)[C@@H]2OC(c4ccc(OC)cc4)OC[C@@H]2N3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H31NO6/c1-31-22-12-8-20(9-13-22)28-33-17-24-26(35-28)27-25(30(24)16-19-6-4-3-5-7-19)18-34-29(36-27)21-10-14-23(32-2)15-11-21/h3-15,24-29H,16-18H2,1-2H3/t24-,25-,26+,27+,28?,29?/m0/s1 |
| InChIKey | NERGZHYBJPSJGG-OQYAIGMYSA-N |
| XLogP | 4.49 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |