C33H37NO5Se — CID 102070162
(1R,2R,4R,7S,9S,12R)-8-[[2-[(1R,2R)-2-methoxycyclopentyl]selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane (PubChem CID 102070162) has the molecular formula C33H37NO5Se and a molecular weight of 606.62 g/mol. Its IUPAC name is (1R,2R,4R,7S,9S,12R)-8-[[2-[(1R,2R)-2-methoxycyclopentyl]selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane.
| Compound Name | (1R,2R,4R,7S,9S,12R)-8-[[2-[(1R,2R)-2-methoxycyclopentyl]selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane |
|---|---|
| PubChem CID | 102070162 |
| Molecular Formula | C33H37NO5Se |
| Molecular Weight | 606.62 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | (1R,2R,4R,7S,9S,12R)-8-[[2-[(1R,2R)-2-methoxycyclopentyl]selanylphenyl]methyl]-4,12-diphenyl-3,5,11,13-tetraoxa-8-azatricyclo[7.4.0.02,7]tridecane |
| SMILES | CO[C@@H]1CCC[C@H]1[Se]c1ccccc1CN1[C@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]2O[C@H](c3ccccc3)OC[C@@H]21 |
| InChI | InChI=1S/C33H37NO5Se/c1-35-27-16-10-18-29(27)40-28-17-9-8-15-24(28)19-34-25-20-36-32(22-11-4-2-5-12-22)38-30(25)31-26(34)21-37-33(39-31)23-13-6-3-7-14-23/h2-9,11-15,17,25-27,29-33H,10,16,18-21H2,1H3/t25-,26-,27+,29+,30+,31+,32+,33+/m0/s1 |
| InChIKey | AFXUOHAKOFFVCW-NCACFGTHSA-N |
| XLogP | 4.78 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|