C22H25FN2O3 — CID 118404473
2-[(4aR,6R,7S,7aR)-5-benzyl-7-fluoro-2-phenyl-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrol-6-yl]-N-methylacetamide (PubChem CID 118404473) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is 2-[(4aR,6R,7S,7aR)-5-benzyl-7-fluoro-2-phenyl-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrol-6-yl]-N-methylacetamide.
| Compound Name | 2-[(4aR,6R,7S,7aR)-5-benzyl-7-fluoro-2-phenyl-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrol-6-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 118404473 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[(4aR,6R,7S,7aR)-5-benzyl-7-fluoro-2-phenyl-4a,6,7,7a-tetrahydro-4H-[1,3]dioxino[5,4-b]pyrrol-6-yl]-N-methylacetamide |
| SMILES | CNC(=O)C[C@@H]1[C@H](F)[C@@H]2OC(c3ccccc3)OC[C@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C22H25FN2O3/c1-24-19(26)12-17-20(23)21-18(25(17)13-15-8-4-2-5-9-15)14-27-22(28-21)16-10-6-3-7-11-16/h2-11,17-18,20-22H,12-14H2,1H3,(H,24,26)/t17-,18-,20+,21-,22?/m1/s1 |
| InChIKey | IZTLHQUDQLSAIR-GHMSFAMASA-N |
| XLogP | 2.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |