C23H25NO7 — CID 15170697
benzyl (2R,4aR,7S,8R,8aR)-7-acetyloxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate (PubChem CID 15170697) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is benzyl (2R,4aR,7S,8R,8aR)-7-acetyloxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate.
| Compound Name | benzyl (2R,4aR,7S,8R,8aR)-7-acetyloxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 15170697 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | benzyl (2R,4aR,7S,8R,8aR)-7-acetyloxy-8-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydro-[1,3]dioxino[5,4-b]pyridine-5-carboxylate |
| SMILES | CC(=O)O[C@H]1CN(C(=O)OCc2ccccc2)[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C23H25NO7/c1-15(25)30-19-12-24(23(27)29-13-16-8-4-2-5-9-16)18-14-28-22(31-21(18)20(19)26)17-10-6-3-7-11-17/h2-11,18-22,26H,12-14H2,1H3/t18-,19+,20-,21-,22-/m1/s1 |
| InChIKey | DIXHZASNRBVUFQ-PVIWCNJMSA-N |
| XLogP | 2.41 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |