C23H24N2O7 — CID 23258331
benzyl (1R,4R,7S,8S)-7,8-diacetyloxy-2-phenyl-3-oxa-2,5-diazabicyclo[2.2.2]octane-5-carboxylate (PubChem CID 23258331) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is benzyl (1R,4R,7S,8S)-7,8-diacetyloxy-2-phenyl-3-oxa-2,5-diazabicyclo[2.2.2]octane-5-carboxylate.
| Compound Name | benzyl (1R,4R,7S,8S)-7,8-diacetyloxy-2-phenyl-3-oxa-2,5-diazabicyclo[2.2.2]octane-5-carboxylate |
|---|---|
| PubChem CID | 23258331 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | benzyl (1R,4R,7S,8S)-7,8-diacetyloxy-2-phenyl-3-oxa-2,5-diazabicyclo[2.2.2]octane-5-carboxylate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H]2ON(c3ccccc3)[C@@H]1CN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H24N2O7/c1-15(26)30-20-19-13-24(23(28)29-14-17-9-5-3-6-10-17)22(21(20)31-16(2)27)32-25(19)18-11-7-4-8-12-18/h3-12,19-22H,13-14H2,1-2H3/t19-,20+,21+,22-/m1/s1 |
| InChIKey | JPWFUJDQHFFSIW-CLAROIROSA-N |
| XLogP | 2.65 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|