C19H25NO7 — CID 11530984
benzyl (4S,5S)-4,5-diacetyloxy-2-hydroxy-3,3-dimethylpiperidine-1-carboxylate (PubChem CID 11530984) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is benzyl (4S,5S)-4,5-diacetyloxy-2-hydroxy-3,3-dimethylpiperidine-1-carboxylate.
| Compound Name | benzyl (4S,5S)-4,5-diacetyloxy-2-hydroxy-3,3-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11530984 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | benzyl (4S,5S)-4,5-diacetyloxy-2-hydroxy-3,3-dimethylpiperidine-1-carboxylate |
| SMILES | CC(=O)O[C@H]1CN(C(=O)OCc2ccccc2)C(O)C(C)(C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H25NO7/c1-12(21)26-15-10-20(17(23)19(3,4)16(15)27-13(2)22)18(24)25-11-14-8-6-5-7-9-14/h5-9,15-17,23H,10-11H2,1-4H3/t15-,16+,17?/m0/s1 |
| InChIKey | BAAYPMMHFNRYJM-RTKIROINSA-N |
| XLogP | 1.85 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|