C20H26N2O7 — CID 10621344
benzyl (2R,4R,5S)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)piperidine-1-carboxylate (PubChem CID 10621344) has the molecular formula C20H26N2O7 and a molecular weight of 406.44 g/mol. Its IUPAC name is benzyl (2R,4R,5S)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2R,4R,5S)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10621344 |
| Molecular Formula | C20H26N2O7 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | benzyl (2R,4R,5S)-5-acetamido-4-acetyloxy-2-(acetyloxymethyl)piperidine-1-carboxylate |
| SMILES | CC(=O)N[C@H]1CN(C(=O)OCc2ccccc2)[C@@H](COC(C)=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H26N2O7/c1-13(23)21-18-10-22(20(26)28-11-16-7-5-4-6-8-16)17(12-27-14(2)24)9-19(18)29-15(3)25/h4-8,17-19H,9-12H2,1-3H3,(H,21,23)/t17-,18+,19-/m1/s1 |
| InChIKey | NWCQJILCYOZGJO-CEXWTWQISA-N |
| XLogP | 1.40 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|