C19H25NO6 — CID 11002985
benzyl (2R,6S)-2,6-bis(acetyloxymethyl)piperidine-1-carboxylate (PubChem CID 11002985) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is benzyl (2R,6S)-2,6-bis(acetyloxymethyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2R,6S)-2,6-bis(acetyloxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11002985 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | benzyl (2R,6S)-2,6-bis(acetyloxymethyl)piperidine-1-carboxylate |
| SMILES | CC(=O)OC[C@H]1CCC[C@@H](COC(C)=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H25NO6/c1-14(21)24-12-17-9-6-10-18(13-25-15(2)22)20(17)19(23)26-11-16-7-4-3-5-8-16/h3-5,7-8,17-18H,6,9-13H2,1-2H3/t17-,18+ |
| InChIKey | DLSSTTUWXUPLIQ-HDICACEKSA-N |
| XLogP | 2.67 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|