C18H23NO2 — CID 11161942
benzyl (2R,6S)-2-ethenyl-6-prop-2-enylpiperidine-1-carboxylate (PubChem CID 11161942) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is benzyl (2R,6S)-2-ethenyl-6-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | benzyl (2R,6S)-2-ethenyl-6-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11161942 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | benzyl (2R,6S)-2-ethenyl-6-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@@H]1CCC[C@H](C=C)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO2/c1-3-9-17-13-8-12-16(4-2)19(17)18(20)21-14-15-10-6-5-7-11-15/h3-7,10-11,16-17H,1-2,8-9,12-14H2/t16-,17+/m0/s1 |
| InChIKey | NGKLECRPWKFHON-DLBZAZTESA-N |
| XLogP | 4.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|