C23H31NO3 — CID 171937882
benzyl 3-hept-6-enoyl-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171937882) has the molecular formula C23H31NO3 and a molecular weight of 369.50 g/mol. Its IUPAC name is benzyl 3-hept-6-enoyl-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | benzyl 3-hept-6-enoyl-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171937882 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | benzyl 3-hept-6-enoyl-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | C=CCCCCC(=O)C1CC2CCCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H31NO3/c1-2-3-4-8-14-22(25)19-15-20-12-9-13-21(16-19)24(20)23(26)27-17-18-10-6-5-7-11-18/h2,5-7,10-11,19-21H,1,3-4,8-9,12-17H2 |
| InChIKey | BDCSVVHUNPVYHG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|