C21H29NO3 — CID 171938598
benzyl 3-hexanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171938598) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is benzyl 3-hexanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | benzyl 3-hexanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 171938598 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | benzyl 3-hexanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCCCCC(=O)C1CC2CCC(C1)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO3/c1-2-3-5-10-20(23)17-13-18-11-12-19(14-17)22(18)21(24)25-15-16-8-6-4-7-9-16/h4,6-9,17-19H,2-3,5,10-15H2,1H3 |
| InChIKey | SZJXMYUAPYPONV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|