benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate

C22H31NO3 — CID 171937944

IUPACbenzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate
SMILESCCCCCCC(=O)C1CC2CCC(C1)N2C(=O)OCc1ccccc1
InChIInChI=1S/C22H31NO3/c1-2-3-4-8-11-21(24)18-14-19-12-13-20(15-18)23(19)22(25)26-16-17-9-6-5-7-10-17/h5-7,9-10,18-20H,2-4,8,11-16H2,1H3
InChIKeyPOJOBYYZGPKRQP-UHFFFAOYSA-N
MW357.49 g/mol
LogP5.11
Rot. Bonds8

About benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate

benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 171937944) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate.

Molecular Properties

Compound Namebenzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate
PubChem CID171937944
Molecular FormulaC22H31NO3
Molecular Weight357.49 g/mol
Exact Mass357.23
IUPAC Namebenzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate
SMILESCCCCCCC(=O)C1CC2CCC(C1)N2C(=O)OCc1ccccc1
InChIInChI=1S/C22H31NO3/c1-2-3-4-8-11-21(24)18-14-19-12-13-20(15-18)23(19)22(25)26-16-17-9-6-5-7-10-17/h5-7,9-10,18-20H,2-4,8,11-16H2,1H3
InChIKeyPOJOBYYZGPKRQP-UHFFFAOYSA-N
XLogP5.11
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500357.49
LogP ≤ 55.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate?
The IUPAC name of benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate (CID 171937944) is benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate.
What is the SMILES notation for benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate?
The canonical SMILES for benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate is CCCCCCC(=O)C1CC2CCC(C1)N2C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate?
The InChIKey is POJOBYYZGPKRQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO3/c1-2-3-4-8-11-21(24)18-14-19-12-13-20(15-18)23(19)22(25)26-16-17-9-6-5-7-10-17/h5-7,9-10,18-20H,2-4,8,11-16H2,1H3.
What are the key properties of benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate?
benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate has a molecular weight of 357.49 g/mol, XLogP of 5.11, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-heptanoyl-8-azabicyclo[3.2.1]octane-8-carboxylate is sourced from PubChem (CID 171937944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).