C26H38N2O6 — CID 67093143
tert-butyl 2-[[[(2S)-1-methoxy-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]methyl]-6-prop-2-enylpiperidine-1-carboxylate (PubChem CID 67093143) has the molecular formula C26H38N2O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is tert-butyl 2-[[[(2S)-1-methoxy-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]methyl]-6-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[[(2S)-1-methoxy-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]methyl]-6-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67093143 |
| Molecular Formula | C26H38N2O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | tert-butyl 2-[[[(2S)-1-methoxy-1-oxopropan-2-yl]-phenylmethoxycarbonylamino]methyl]-6-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CCC1CCCC(CN(C(=O)OCc2ccccc2)[C@@H](C)C(=O)OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H38N2O6/c1-7-12-21-15-11-16-22(28(21)25(31)34-26(3,4)5)17-27(19(2)23(29)32-6)24(30)33-18-20-13-9-8-10-14-20/h7-10,13-14,19,21-22H,1,11-12,15-18H2,2-6H3/t19-,21?,22?/m0/s1 |
| InChIKey | UPFIZSUEXOXEMI-KPQWGBOZSA-N |
| XLogP | 4.92 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|