C25H34N2O5 — CID 11178230
benzyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]-5-prop-2-enylpyrrolidine-2-carboxylate (PubChem CID 11178230) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is benzyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]-5-prop-2-enylpyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]-5-prop-2-enylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11178230 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | benzyl (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]-5-prop-2-enylpyrrolidine-2-carboxylate |
| SMILES | C=CCC1CC[C@@H](C(=O)OCc2ccccc2)N1C(=O)[C@H](CC=C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H34N2O5/c1-6-11-19-15-16-21(23(29)31-17-18-13-9-8-10-14-18)27(19)22(28)20(12-7-2)26-24(30)32-25(3,4)5/h6-10,13-14,19-21H,1-2,11-12,15-17H2,3-5H3,(H,26,30)/t19?,20-,21-/m0/s1 |
| InChIKey | XYNGEDMKGRWSQU-AKQSQHNNSA-N |
| XLogP | 4.13 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|