C30H36FN3O6 — CID 67891498
benzyl (3aR,6S,6aS)-6-(4-fluorophenoxy)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 67891498) has the molecular formula C30H36FN3O6 and a molecular weight of 553.63 g/mol. Its IUPAC name is benzyl (3aR,6S,6aS)-6-(4-fluorophenoxy)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl (3aR,6S,6aS)-6-(4-fluorophenoxy)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 67891498 |
| Molecular Formula | C30H36FN3O6 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | benzyl (3aR,6S,6aS)-6-(4-fluorophenoxy)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | C=CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H]2[C@H]1[C@@H](Oc1ccc(F)cc1)CN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H36FN3O6/c1-5-9-23(32-28(36)40-30(2,3)4)27(35)33-17-16-24-26(33)25(39-22-14-12-21(31)13-15-22)18-34(24)29(37)38-19-20-10-7-6-8-11-20/h5-8,10-15,23-26H,1,9,16-19H2,2-4H3,(H,32,36)/t23-,24+,25-,26-/m0/s1 |
| InChIKey | NGUPKWSEITYIPV-QYOOZWMWSA-N |
| XLogP | 4.66 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|