C26H31N3O6 — CID 70822594
(3aR,6S,6aS)-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]-6-phenoxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid (PubChem CID 70822594) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is (3aR,6S,6aS)-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]-6-phenoxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid.
| Compound Name | (3aR,6S,6aS)-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]-6-phenoxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 70822594 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (3aR,6S,6aS)-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]-6-phenoxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylic acid |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N1CC[C@@H]2[C@H]1[C@@H](Oc1ccccc1)CN2C(=O)O |
| InChI | InChI=1S/C26H31N3O6/c1-17(2)22(27-25(31)34-16-18-9-5-3-6-10-18)24(30)28-14-13-20-23(28)21(15-29(20)26(32)33)35-19-11-7-4-8-12-19/h3-12,17,20-23H,13-16H2,1-2H3,(H,27,31)(H,32,33)/t20-,21+,22+,23+/m1/s1 |
| InChIKey | AIXXHRWMOHSAAM-LDVJMBRRSA-N |
| XLogP | 3.35 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |