C31H39F2N3O5 — CID 67607614
benzyl N-[1-[6-(3,4-difluorophenoxy)-4-(oxan-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 67607614) has the molecular formula C31H39F2N3O5 and a molecular weight of 571.67 g/mol. Its IUPAC name is benzyl N-[1-[6-(3,4-difluorophenoxy)-4-(oxan-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[6-(3,4-difluorophenoxy)-4-(oxan-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67607614 |
| Molecular Formula | C31H39F2N3O5 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | benzyl N-[1-[6-(3,4-difluorophenoxy)-4-(oxan-4-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)C(NC(=O)OCc1ccccc1)C(=O)N1CCC2C1C(Oc1ccc(F)c(F)c1)CN2C1CCOCC1 |
| InChI | InChI=1S/C31H39F2N3O5/c1-31(2,3)28(34-30(38)40-19-20-7-5-4-6-8-20)29(37)35-14-11-25-27(35)26(18-36(25)21-12-15-39-16-13-21)41-22-9-10-23(32)24(33)17-22/h4-10,17,21,25-28H,11-16,18-19H2,1-3H3,(H,34,38) |
| InChIKey | KCNVENSVSKEOAM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |