C25H37F2N3O3 — CID 157291769
(2R)-N-[(2S)-1-[(3aR,6S,6aS)-6-(3,4-difluorophenoxy)-4-ethyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-methylbutanamide (PubChem CID 157291769) has the molecular formula C25H37F2N3O3 and a molecular weight of 465.59 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-[(3aR,6S,6aS)-6-(3,4-difluorophenoxy)-4-ethyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-methylbutanamide.
| Compound Name | (2R)-N-[(2S)-1-[(3aR,6S,6aS)-6-(3,4-difluorophenoxy)-4-ethyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-methylbutanamide |
|---|---|
| PubChem CID | 157291769 |
| Molecular Formula | C25H37F2N3O3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | (2R)-N-[(2S)-1-[(3aR,6S,6aS)-6-(3,4-difluorophenoxy)-4-ethyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]-2-methylbutanamide |
| SMILES | CC[C@@H](C)C(=O)N[C@H](C(=O)N1CC[C@@H]2[C@H]1[C@@H](Oc1ccc(F)c(F)c1)CN2CC)C(C)(C)C |
| InChI | InChI=1S/C25H37F2N3O3/c1-7-15(3)23(31)28-22(25(4,5)6)24(32)30-12-11-19-21(30)20(14-29(19)8-2)33-16-9-10-17(26)18(27)13-16/h9-10,13,15,19-22H,7-8,11-12,14H2,1-6H3,(H,28,31)/t15-,19-,20+,21+,22-/m1/s1 |
| InChIKey | BAWUOUBUOSDRRL-ZPCZRFHTSA-N |
| XLogP | 3.59 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |