C26H40N4O5 — CID 67609028
tert-butyl 1-[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]-6-phenoxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 67609028) has the molecular formula C26H40N4O5 and a molecular weight of 488.63 g/mol. Its IUPAC name is tert-butyl 1-[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]-6-phenoxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl 1-[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]-6-phenoxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 67609028 |
| Molecular Formula | C26H40N4O5 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | tert-butyl 1-[3-methyl-2-[2-(methylamino)propanoylamino]butanoyl]-6-phenoxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2C1C(Oc1ccccc1)CN2C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C26H40N4O5/c1-16(2)21(28-23(31)17(3)27-7)24(32)29-14-13-19-22(29)20(34-18-11-9-8-10-12-18)15-30(19)25(33)35-26(4,5)6/h8-12,16-17,19-22,27H,13-15H2,1-7H3,(H,28,31) |
| InChIKey | COHWZLGMAVMQJO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |