C32H39N5O6 — CID 88586513
benzyl (3aR,6S,6aR)-1-[(2S,3R)-2-[[(2S)-2-(methylamino)propanoyl]amino]-3-prop-2-ynoxybutanoyl]-6-(phenylcarbamoyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 88586513) has the molecular formula C32H39N5O6 and a molecular weight of 589.69 g/mol. Its IUPAC name is benzyl (3aR,6S,6aR)-1-[(2S,3R)-2-[[(2S)-2-(methylamino)propanoyl]amino]-3-prop-2-ynoxybutanoyl]-6-(phenylcarbamoyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl (3aR,6S,6aR)-1-[(2S,3R)-2-[[(2S)-2-(methylamino)propanoyl]amino]-3-prop-2-ynoxybutanoyl]-6-(phenylcarbamoyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 88586513 |
| Molecular Formula | C32H39N5O6 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | benzyl (3aR,6S,6aR)-1-[(2S,3R)-2-[[(2S)-2-(methylamino)propanoyl]amino]-3-prop-2-ynoxybutanoyl]-6-(phenylcarbamoyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | C#CCO[C@H](C)[C@H](NC(=O)[C@H](C)NC)C(=O)N1CC[C@@H]2[C@H]1[C@@H](C(=O)Nc1ccccc1)CN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H39N5O6/c1-5-18-42-22(3)27(35-29(38)21(2)33-4)31(40)36-17-16-26-28(36)25(30(39)34-24-14-10-7-11-15-24)19-37(26)32(41)43-20-23-12-8-6-9-13-23/h1,6-15,21-22,25-28,33H,16-20H2,2-4H3,(H,34,39)(H,35,38)/t21-,22+,25-,26+,27-,28+/m0/s1 |
| InChIKey | PJXZZCZTHDSKMV-ZTDLBOGWSA-N |
| XLogP | 1.99 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|