C34H39N5O5S — CID 88934099
benzyl (3aR,6S,6aR)-1-[(2S,3R)-2-[[(2S)-2-(methylamino)propanoyl]amino]-3-prop-2-ynoxybutanoyl]-6-(4-phenyl-1,3-thiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 88934099) has the molecular formula C34H39N5O5S and a molecular weight of 629.78 g/mol. Its IUPAC name is benzyl (3aR,6S,6aR)-1-[(2S,3R)-2-[[(2S)-2-(methylamino)propanoyl]amino]-3-prop-2-ynoxybutanoyl]-6-(4-phenyl-1,3-thiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl (3aR,6S,6aR)-1-[(2S,3R)-2-[[(2S)-2-(methylamino)propanoyl]amino]-3-prop-2-ynoxybutanoyl]-6-(4-phenyl-1,3-thiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 88934099 |
| Molecular Formula | C34H39N5O5S |
| Molecular Weight | 629.78 g/mol |
| Exact Mass | 629.27 |
| IUPAC Name | benzyl (3aR,6S,6aR)-1-[(2S,3R)-2-[[(2S)-2-(methylamino)propanoyl]amino]-3-prop-2-ynoxybutanoyl]-6-(4-phenyl-1,3-thiazol-2-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | C#CCO[C@H](C)[C@H](NC(=O)[C@H](C)NC)C(=O)N1CC[C@@H]2[C@H]1[C@@H](c1nc(-c3ccccc3)cs1)CN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H39N5O5S/c1-5-18-43-23(3)29(37-31(40)22(2)35-4)33(41)38-17-16-28-30(38)26(32-36-27(21-45-32)25-14-10-7-11-15-25)19-39(28)34(42)44-20-24-12-8-6-9-13-24/h1,6-15,21-23,26,28-30,35H,16-20H2,2-4H3,(H,37,40)/t22-,23+,26-,28+,29-,30+/m0/s1 |
| InChIKey | OIQYKVODOZIJHG-JVLKDCSASA-N |
| XLogP | 3.65 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.78 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|