C34H45N7O4 — CID 75985699
benzyl 6-[(4-benzyltriazol-1-yl)methyl]-1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 75985699) has the molecular formula C34H45N7O4 and a molecular weight of 615.78 g/mol. Its IUPAC name is benzyl 6-[(4-benzyltriazol-1-yl)methyl]-1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | benzyl 6-[(4-benzyltriazol-1-yl)methyl]-1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 75985699 |
| Molecular Formula | C34H45N7O4 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.35 |
| IUPAC Name | benzyl 6-[(4-benzyltriazol-1-yl)methyl]-1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2C1C(Cn1cc(Cc3ccccc3)nn1)CN2C(=O)OCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H45N7O4/c1-23(35-5)31(42)36-30(34(2,3)4)32(43)40-17-16-28-29(40)26(20-41(28)33(44)45-22-25-14-10-7-11-15-25)19-39-21-27(37-38-39)18-24-12-8-6-9-13-24/h6-15,21,23,26,28-30,35H,16-20,22H2,1-5H3,(H,36,42) |
| InChIKey | KNZLDDBVIPLBMM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 121.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |