C20H37N5O4 — CID 67606682
1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-6-hydroxy-N-propyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide (PubChem CID 67606682) has the molecular formula C20H37N5O4 and a molecular weight of 411.55 g/mol. Its IUPAC name is 1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-6-hydroxy-N-propyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide.
| Compound Name | 1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-6-hydroxy-N-propyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 67606682 |
| Molecular Formula | C20H37N5O4 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 1-[3,3-dimethyl-2-[2-(methylamino)propanoylamino]butanoyl]-6-hydroxy-N-propyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
| SMILES | CCCNC(=O)N1CC(O)C2C1CCN2C(=O)C(NC(=O)C(C)NC)C(C)(C)C |
| InChI | InChI=1S/C20H37N5O4/c1-7-9-22-19(29)25-11-14(26)15-13(25)8-10-24(15)18(28)16(20(3,4)5)23-17(27)12(2)21-6/h12-16,21,26H,7-11H2,1-6H3,(H,22,29)(H,23,27) |
| InChIKey | IOPGPYFEPUGJPL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |