C16H30N4O3 — CID 67609207
1-(2-amino-3,3-dimethylbutanoyl)-6-hydroxy-N-propyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide (PubChem CID 67609207) has the molecular formula C16H30N4O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 1-(2-amino-3,3-dimethylbutanoyl)-6-hydroxy-N-propyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide.
| Compound Name | 1-(2-amino-3,3-dimethylbutanoyl)-6-hydroxy-N-propyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 67609207 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 1-(2-amino-3,3-dimethylbutanoyl)-6-hydroxy-N-propyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
| SMILES | CCCNC(=O)N1CC(O)C2C1CCN2C(=O)C(N)C(C)(C)C |
| InChI | InChI=1S/C16H30N4O3/c1-5-7-18-15(23)20-9-11(21)12-10(20)6-8-19(12)14(22)13(17)16(2,3)4/h10-13,21H,5-9,17H2,1-4H3,(H,18,23) |
| InChIKey | HQZQJMSYANHKOD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |