C19H27N3O3 — CID 142671545
2-amino-1-[(6S)-4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-4-methylpentan-1-one (PubChem CID 142671545) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-amino-1-[(6S)-4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-4-methylpentan-1-one.
| Compound Name | 2-amino-1-[(6S)-4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 142671545 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-amino-1-[(6S)-4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-4-methylpentan-1-one |
| SMILES | CC(C)CC(N)C(=O)N1CCC2C1[C@@H](O)CN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H27N3O3/c1-12(2)10-14(20)19(25)21-9-8-15-17(21)16(23)11-22(15)18(24)13-6-4-3-5-7-13/h3-7,12,14-17,23H,8-11,20H2,1-2H3/t14?,15?,16-,17?/m0/s1 |
| InChIKey | AJPSKJWLQVOZCQ-PYCMUAIMSA-N |
| XLogP | 0.85 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |