C14H16N2O3S — CID 91475591
4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carbothioic S-acid (PubChem CID 91475591) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carbothioic S-acid.
| Compound Name | 4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carbothioic S-acid |
|---|---|
| PubChem CID | 91475591 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carbothioic S-acid |
| SMILES | O=C(c1ccccc1)N1CC(O)C2C1CCN2C(=O)S |
| InChI | InChI=1S/C14H16N2O3S/c17-11-8-16(13(18)9-4-2-1-3-5-9)10-6-7-15(12(10)11)14(19)20/h1-5,10-12,17H,6-8H2,(H,19,20) |
| InChIKey | BZYMTNUIYUXPQY-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|