C23H26N2O5 — CID 68957638
(2-propan-2-yloxyphenyl) (3aR,6S,6aS)-4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate (PubChem CID 68957638) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2-propan-2-yloxyphenyl) (3aR,6S,6aS)-4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate.
| Compound Name | (2-propan-2-yloxyphenyl) (3aR,6S,6aS)-4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 68957638 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (2-propan-2-yloxyphenyl) (3aR,6S,6aS)-4-benzoyl-6-hydroxy-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1-carboxylate |
| SMILES | CC(C)Oc1ccccc1OC(=O)N1CC[C@@H]2[C@H]1[C@@H](O)CN2C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H26N2O5/c1-15(2)29-19-10-6-7-11-20(19)30-23(28)24-13-12-17-21(24)18(26)14-25(17)22(27)16-8-4-3-5-9-16/h3-11,15,17-18,21,26H,12-14H2,1-2H3/t17-,18+,21+/m1/s1 |
| InChIKey | WLXUBVSRFPXNLR-LQWHRVPQSA-N |
| XLogP | 2.93 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |