C17H24N2O2 — CID 155873390
[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(3-propan-2-yloxyphenyl)methanone (PubChem CID 155873390) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(3-propan-2-yloxyphenyl)methanone.
| Compound Name | [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(3-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 155873390 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(3-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1cccc(C(=O)N2CC[C@H]3CN(C)C[C@H]32)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-12(2)21-15-6-4-5-13(9-15)17(20)19-8-7-14-10-18(3)11-16(14)19/h4-6,9,12,14,16H,7-8,10-11H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | RUTQTZNNJHCJPZ-GOEBONIOSA-N |
| XLogP | 2.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |