C16H22ClNO2 — CID 63397763
[4-(chloromethyl)piperidin-1-yl]-(3-propan-2-yloxyphenyl)methanone (PubChem CID 63397763) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is [4-(chloromethyl)piperidin-1-yl]-(3-propan-2-yloxyphenyl)methanone.
| Compound Name | [4-(chloromethyl)piperidin-1-yl]-(3-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 63397763 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | [4-(chloromethyl)piperidin-1-yl]-(3-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1cccc(C(=O)N2CCC(CCl)CC2)c1 |
| InChI | InChI=1S/C16H22ClNO2/c1-12(2)20-15-5-3-4-14(10-15)16(19)18-8-6-13(11-17)7-9-18/h3-5,10,12-13H,6-9,11H2,1-2H3 |
| InChIKey | MWOVGSNQUTZGLP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|