C14H16ClF2NO2 — CID 63397857
[4-(chloromethyl)piperidin-1-yl]-[4-(difluoromethoxy)phenyl]methanone (PubChem CID 63397857) has the molecular formula C14H16ClF2NO2 and a molecular weight of 303.74 g/mol. Its IUPAC name is [4-(chloromethyl)piperidin-1-yl]-[4-(difluoromethoxy)phenyl]methanone.
| Compound Name | [4-(chloromethyl)piperidin-1-yl]-[4-(difluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 63397857 |
| Molecular Formula | C14H16ClF2NO2 |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | [4-(chloromethyl)piperidin-1-yl]-[4-(difluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OC(F)F)cc1)N1CCC(CCl)CC1 |
| InChI | InChI=1S/C14H16ClF2NO2/c15-9-10-5-7-18(8-6-10)13(19)11-1-3-12(4-2-11)20-14(16)17/h1-4,10,14H,5-9H2 |
| InChIKey | DUAICDOMUVTGOP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|