C16H21F2N3O2 — CID 124757608
[4-(difluoromethoxy)phenyl]-[4-[(3R)-pyrrolidin-3-yl]piperazin-1-yl]methanone (PubChem CID 124757608) has the molecular formula C16H21F2N3O2 and a molecular weight of 325.36 g/mol. Its IUPAC name is [4-(difluoromethoxy)phenyl]-[4-[(3R)-pyrrolidin-3-yl]piperazin-1-yl]methanone.
| Compound Name | [4-(difluoromethoxy)phenyl]-[4-[(3R)-pyrrolidin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 124757608 |
| Molecular Formula | C16H21F2N3O2 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | [4-(difluoromethoxy)phenyl]-[4-[(3R)-pyrrolidin-3-yl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(OC(F)F)cc1)N1CCN([C@@H]2CCNC2)CC1 |
| InChI | InChI=1S/C16H21F2N3O2/c17-16(18)23-14-3-1-12(2-4-14)15(22)21-9-7-20(8-10-21)13-5-6-19-11-13/h1-4,13,16,19H,5-11H2/t13-/m1/s1 |
| InChIKey | WRNPJNUMGXPOMM-CYBMUJFWSA-N |
| XLogP | 1.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |