C22H27N3O — CID 155948017
2,2-diphenyl-1-(4-pyrrolidin-3-ylpiperazin-1-yl)ethanone (PubChem CID 155948017) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 2,2-diphenyl-1-(4-pyrrolidin-3-ylpiperazin-1-yl)ethanone.
| Compound Name | 2,2-diphenyl-1-(4-pyrrolidin-3-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 155948017 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 2,2-diphenyl-1-(4-pyrrolidin-3-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1CCN(C2CCNC2)CC1 |
| InChI | InChI=1S/C22H27N3O/c26-22(25-15-13-24(14-16-25)20-11-12-23-17-20)21(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,20-21,23H,11-17H2 |
| InChIKey | MCEGEDZRDUILEY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |