C16H22N2O3 — CID 155873161
[(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(2,4-dimethoxyphenyl)methanone (PubChem CID 155873161) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(2,4-dimethoxyphenyl)methanone.
| Compound Name | [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(2,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 155873161 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | [(3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-(2,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CC[C@H]3CN(C)C[C@H]32)c(OC)c1 |
| InChI | InChI=1S/C16H22N2O3/c1-17-9-11-6-7-18(14(11)10-17)16(19)13-5-4-12(20-2)8-15(13)21-3/h4-5,8,11,14H,6-7,9-10H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | YMQPJRUQXJNGRS-SMDDNHRTSA-N |
| XLogP | 1.48 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |