About (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate
(2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate (PubChem CID 142632527) has the molecular formula C18H19NO4
and a molecular weight of 313.35 g/mol. Its IUPAC name is (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate.
Molecular Properties
| Compound Name | (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate |
| PubChem CID | 142632527 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate |
| SMILES | O=C(Oc1ccccc1Oc1ccccc1)N1CCCCC1O |
| InChI | InChI=1S/C18H19NO4/c20-17-12-6-7-13-19(17)18(21)23-16-11-5-4-10-15(16)22-14-8-2-1-3-9-14/h1-5,8-11,17,20H,6-7,12-13H2 |
| InChIKey | NNFKWZBOTJCPTC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate?
The IUPAC name of (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate (CID 142632527) is (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate.
What is the SMILES notation for (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate?
The canonical SMILES for (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate is O=C(Oc1ccccc1Oc1ccccc1)N1CCCCC1O.
What is the InChIKey of (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate?
The InChIKey is NNFKWZBOTJCPTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4/c20-17-12-6-7-13-19(17)18(21)23-16-11-5-4-10-15(16)22-14-8-2-1-3-9-14/h1-5,8-11,17,20H,6-7,12-13H2.
What are the key properties of (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate?
(2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate has a molecular weight of 313.35 g/mol, XLogP of 3.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenoxyphenyl) 2-hydroxypiperidine-1-carboxylate is sourced from PubChem (CID 142632527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).