C12H16N2O2 — CID 140622685
2-phenoxypiperidine-1-carboxamide (PubChem CID 140622685) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-phenoxypiperidine-1-carboxamide.
| Compound Name | 2-phenoxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 140622685 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-phenoxypiperidine-1-carboxamide |
| SMILES | NC(=O)N1CCCCC1Oc1ccccc1 |
| InChI | InChI=1S/C12H16N2O2/c13-12(15)14-9-5-4-8-11(14)16-10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2,(H2,13,15) |
| InChIKey | DXMNWGAQTADLGC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |