C12H15NO3 — CID 129388318
phenyl (2S)-2-methoxypyrrolidine-1-carboxylate (PubChem CID 129388318) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is phenyl (2S)-2-methoxypyrrolidine-1-carboxylate.
| Compound Name | phenyl (2S)-2-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 129388318 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | phenyl (2S)-2-methoxypyrrolidine-1-carboxylate |
| SMILES | CO[C@H]1CCCN1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C12H15NO3/c1-15-11-8-5-9-13(11)12(14)16-10-6-3-2-4-7-10/h2-4,6-7,11H,5,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | JRMHDPZZHCRQIJ-NSHDSACASA-N |
| XLogP | 2.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |