C12H17ClN2OS — CID 140622707
2-phenylsulfanylpiperidine-1-carboxamide;hydrochloride (PubChem CID 140622707) has the molecular formula C12H17ClN2OS and a molecular weight of 272.80 g/mol. Its IUPAC name is 2-phenylsulfanylpiperidine-1-carboxamide;hydrochloride.
| Compound Name | 2-phenylsulfanylpiperidine-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 140622707 |
| Molecular Formula | C12H17ClN2OS |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-phenylsulfanylpiperidine-1-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)N1CCCCC1Sc1ccccc1 |
| InChI | InChI=1S/C12H16N2OS.ClH/c13-12(15)14-9-5-4-8-11(14)16-10-6-2-1-3-7-10;/h1-3,6-7,11H,4-5,8-9H2,(H2,13,15);1H |
| InChIKey | RZXABPWRZCNQJE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |