C24H36FN3O4 — CID 67506208
tert-butyl 1-(2-amino-3,3-dimethylbutanoyl)-6-[(4-fluorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate (PubChem CID 67506208) has the molecular formula C24H36FN3O4 and a molecular weight of 449.57 g/mol. Its IUPAC name is tert-butyl 1-(2-amino-3,3-dimethylbutanoyl)-6-[(4-fluorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl 1-(2-amino-3,3-dimethylbutanoyl)-6-[(4-fluorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 67506208 |
| Molecular Formula | C24H36FN3O4 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | tert-butyl 1-(2-amino-3,3-dimethylbutanoyl)-6-[(4-fluorophenyl)methoxy]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCc2ccc(F)cc2)C2C1CCN2C(=O)C(N)C(C)(C)C |
| InChI | InChI=1S/C24H36FN3O4/c1-23(2,3)20(26)21(29)27-12-11-17-19(27)18(13-28(17)22(30)32-24(4,5)6)31-14-15-7-9-16(25)10-8-15/h7-10,17-20H,11-14,26H2,1-6H3 |
| InChIKey | XJYORNAFBWDEPT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |