C27H30FN3O4S — CID 163919229
4-O-benzyl 1-O-tert-butyl (3aR,6aS)-6-[(6-fluoro-1H-indol-3-yl)sulfanyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate (PubChem CID 163919229) has the molecular formula C27H30FN3O4S and a molecular weight of 511.62 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl (3aR,6aS)-6-[(6-fluoro-1H-indol-3-yl)sulfanyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl (3aR,6aS)-6-[(6-fluoro-1H-indol-3-yl)sulfanyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate |
|---|---|
| PubChem CID | 163919229 |
| Molecular Formula | C27H30FN3O4S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl (3aR,6aS)-6-[(6-fluoro-1H-indol-3-yl)sulfanyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@H]1C(Sc1c[nH]c3cc(F)ccc13)CN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H30FN3O4S/c1-27(2,3)35-26(33)30-12-11-21-24(30)23(36-22-14-29-20-13-18(28)9-10-19(20)22)15-31(21)25(32)34-16-17-7-5-4-6-8-17/h4-10,13-14,21,23-24,29H,11-12,15-16H2,1-3H3/t21-,23?,24+/m1/s1 |
| InChIKey | QYYSSEFWKYKGCK-NXIFTKICSA-N |
| XLogP | 5.80 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |