C27H31N3O4 — CID 67410613
4-O-benzyl 1-O-tert-butyl (3aR,6aR)-5-(1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate (PubChem CID 67410613) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl (3aR,6aR)-5-(1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl (3aR,6aR)-5-(1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate |
|---|---|
| PubChem CID | 67410613 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl (3aR,6aR)-5-(1H-indol-3-yl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2[C@H]1CC(c1c[nH]c3ccccc13)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H31N3O4/c1-27(2,3)34-25(31)29-14-13-22-24(29)15-23(20-16-28-21-12-8-7-11-19(20)21)30(22)26(32)33-17-18-9-5-4-6-10-18/h4-12,16,22-24,28H,13-15,17H2,1-3H3/t22-,23?,24-/m1/s1 |
| InChIKey | ZXHINXIFBXWSOP-NZNOWSIYSA-N |
| XLogP | 5.63 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |