C21H32FN3O2 — CID 143960854
tert-butyl 2-[2-amino-1-(6-fluoro-1H-indol-3-yl)ethyl]pyrrolidine-1-carboxylate;ethane (PubChem CID 143960854) has the molecular formula C21H32FN3O2 and a molecular weight of 377.50 g/mol. Its IUPAC name is tert-butyl 2-[2-amino-1-(6-fluoro-1H-indol-3-yl)ethyl]pyrrolidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 2-[2-amino-1-(6-fluoro-1H-indol-3-yl)ethyl]pyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143960854 |
| Molecular Formula | C21H32FN3O2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | tert-butyl 2-[2-amino-1-(6-fluoro-1H-indol-3-yl)ethyl]pyrrolidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCCC1C(CN)c1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C19H26FN3O2.C2H6/c1-19(2,3)25-18(24)23-8-4-5-17(23)14(10-21)15-11-22-16-9-12(20)6-7-13(15)16;1-2/h6-7,9,11,14,17,22H,4-5,8,10,21H2,1-3H3;1-2H3 |
| InChIKey | PGMOITQFRYHPDQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |