C19H24FN3O2 — CID 143960918
tert-butyl (3aR,6aR)-6-(6-fluoro-1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate (PubChem CID 143960918) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is tert-butyl (3aR,6aR)-6-(6-fluoro-1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (3aR,6aR)-6-(6-fluoro-1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 143960918 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | tert-butyl (3aR,6aR)-6-(6-fluoro-1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2NCC(c3c[nH]c4cc(F)ccc34)[C@H]21 |
| InChI | InChI=1S/C19H24FN3O2/c1-19(2,3)25-18(24)23-7-6-15-17(23)14(10-21-15)13-9-22-16-8-11(20)4-5-12(13)16/h4-5,8-9,14-15,17,21-22H,6-7,10H2,1-3H3/t14?,15-,17-/m1/s1 |
| InChIKey | OXBADYMDOWFHFS-HOSQGPGDSA-N |
| XLogP | 3.37 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |