C30H46BrFN4O3 — CID 143960851
bromomethane;tert-butyl N-[1-cyclohexyl-2-[(6S)-6-(6-fluoro-1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-2-oxoethyl]carbamate;ethane (PubChem CID 143960851) has the molecular formula C30H46BrFN4O3 and a molecular weight of 609.63 g/mol. Its IUPAC name is bromomethane;tert-butyl N-[1-cyclohexyl-2-[(6S)-6-(6-fluoro-1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-2-oxoethyl]carbamate;ethane.
| Compound Name | bromomethane;tert-butyl N-[1-cyclohexyl-2-[(6S)-6-(6-fluoro-1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-2-oxoethyl]carbamate;ethane |
|---|---|
| PubChem CID | 143960851 |
| Molecular Formula | C30H46BrFN4O3 |
| Molecular Weight | 609.63 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | bromomethane;tert-butyl N-[1-cyclohexyl-2-[(6S)-6-(6-fluoro-1H-indol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-2-oxoethyl]carbamate;ethane |
| SMILES | CBr.CC.CC(C)(C)OC(=O)NC(C(=O)N1CCC2NC[C@H](c3c[nH]c4cc(F)ccc34)C21)C1CCCCC1 |
| InChI | InChI=1S/C27H37FN4O3.C2H6.CH3Br/c1-27(2,3)35-26(34)31-23(16-7-5-4-6-8-16)25(33)32-12-11-21-24(32)20(15-29-21)19-14-30-22-13-17(28)9-10-18(19)22;2*1-2/h9-10,13-14,16,20-21,23-24,29-30H,4-8,11-12,15H2,1-3H3,(H,31,34);1-2H3;1H3/t20-,21?,23?,24?;;/m1../s1 |
| InChIKey | HHXGPSAXPHYXAX-NIRIFZLPSA-N |
| XLogP | 6.47 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|