C33H42FN5O2 — CID 45138851
(2S)-N-[(1S)-2-[(3aR,6S,6aR)-6-(1-benzyl-6-fluoroindol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide (PubChem CID 45138851) has the molecular formula C33H42FN5O2 and a molecular weight of 559.73 g/mol. Its IUPAC name is (2S)-N-[(1S)-2-[(3aR,6S,6aR)-6-(1-benzyl-6-fluoroindol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(1S)-2-[(3aR,6S,6aR)-6-(1-benzyl-6-fluoroindol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 45138851 |
| Molecular Formula | C33H42FN5O2 |
| Molecular Weight | 559.73 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | (2S)-N-[(1S)-2-[(3aR,6S,6aR)-6-(1-benzyl-6-fluoroindol-3-yl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrol-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H](C(=O)N1CC[C@H]2NC[C@H](c3cn(Cc4ccccc4)c4cc(F)ccc34)[C@H]21)C1CCCCC1 |
| InChI | InChI=1S/C33H42FN5O2/c1-21(35-2)32(40)37-30(23-11-7-4-8-12-23)33(41)39-16-15-28-31(39)26(18-36-28)27-20-38(19-22-9-5-3-6-10-22)29-17-24(34)13-14-25(27)29/h3,5-6,9-10,13-14,17,20-21,23,26,28,30-31,35-36H,4,7-8,11-12,15-16,18-19H2,1-2H3,(H,37,40)/t21-,26+,28+,30-,31+/m0/s1 |
| InChIKey | YGUSRFZFDFCZNV-LJFYZJGBSA-N |
| XLogP | 4.16 |
| TPSA | 78.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.73 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |