C25H37N5O3 — CID 75300934
1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-N-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-6-carboxamide (PubChem CID 75300934) has the molecular formula C25H37N5O3 and a molecular weight of 455.60 g/mol. Its IUPAC name is 1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-N-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-6-carboxamide.
| Compound Name | 1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-N-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 75300934 |
| Molecular Formula | C25H37N5O3 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-N-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-6-carboxamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2NCC(C(=O)Nc3ccccc3)C21)C1CCCCC1 |
| InChI | InChI=1S/C25H37N5O3/c1-16(26-2)23(31)29-21(17-9-5-3-6-10-17)25(33)30-14-13-20-22(30)19(15-27-20)24(32)28-18-11-7-4-8-12-18/h4,7-8,11-12,16-17,19-22,26-27H,3,5-6,9-10,13-15H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | XZVGZDJJCDYGAO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |