C26H45N5O5S — CID 67280915
N-cyclohexyl-1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide (PubChem CID 67280915) has the molecular formula C26H45N5O5S and a molecular weight of 539.74 g/mol. Its IUPAC name is N-cyclohexyl-1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide.
| Compound Name | N-cyclohexyl-1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 67280915 |
| Molecular Formula | C26H45N5O5S |
| Molecular Weight | 539.74 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | N-cyclohexyl-1-[2-cyclohexyl-2-[2-(methylamino)propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide |
| SMILES | CNC(C)C(=O)NC(C(=O)N1CCC2C1C(C(=O)NC1CCCCC1)CN2S(C)(=O)=O)C1CCCCC1 |
| InChI | InChI=1S/C26H45N5O5S/c1-17(27-2)24(32)29-22(18-10-6-4-7-11-18)26(34)30-15-14-21-23(30)20(16-31(21)37(3,35)36)25(33)28-19-12-8-5-9-13-19/h17-23,27H,4-16H2,1-3H3,(H,28,33)(H,29,32) |
| InChIKey | UZOLNASCOHMBCH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.74 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |