C24H36N4O4S — CID 163532161
(3aR,6S)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-methylsulfonyl-N-[(1R)-1-phenylethyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide (PubChem CID 163532161) has the molecular formula C24H36N4O4S and a molecular weight of 476.64 g/mol. Its IUPAC name is (3aR,6S)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-methylsulfonyl-N-[(1R)-1-phenylethyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-methylsulfonyl-N-[(1R)-1-phenylethyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 163532161 |
| Molecular Formula | C24H36N4O4S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | (3aR,6S)-1-[(2S)-2-amino-2-cyclohexylacetyl]-4-methylsulfonyl-N-[(1R)-1-phenylethyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@H]1CN(S(C)(=O)=O)[C@@H]2CCN(C(=O)[C@@H](N)C3CCCCC3)C12)c1ccccc1 |
| InChI | InChI=1S/C24H36N4O4S/c1-16(17-9-5-3-6-10-17)26-23(29)19-15-28(33(2,31)32)20-13-14-27(22(19)20)24(30)21(25)18-11-7-4-8-12-18/h3,5-6,9-10,16,18-22H,4,7-8,11-15,25H2,1-2H3,(H,26,29)/t16-,19+,20-,21+,22?/m1/s1 |
| InChIKey | DTXCFARJLUXRHB-FZDQLYAASA-N |
| XLogP | 1.63 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |