C25H44N4O8S — CID 90737588
1-[2-cyclohexyl-2-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-methylamino]propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxylic acid (PubChem CID 90737588) has the molecular formula C25H44N4O8S and a molecular weight of 560.71 g/mol. Its IUPAC name is 1-[2-cyclohexyl-2-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-methylamino]propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxylic acid.
| Compound Name | 1-[2-cyclohexyl-2-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-methylamino]propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxylic acid |
|---|---|
| PubChem CID | 90737588 |
| Molecular Formula | C25H44N4O8S |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 1-[2-cyclohexyl-2-[2-[[hydroxy-[(2-methylpropan-2-yl)oxy]methyl]-methylamino]propanoylamino]acetyl]-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-6-carboxylic acid |
| SMILES | CC(C(=O)NC(C(=O)N1CCC2C1C(C(=O)O)CN2S(C)(=O)=O)C1CCCCC1)N(C)C(O)OC(C)(C)C |
| InChI | InChI=1S/C25H44N4O8S/c1-15(27(5)24(34)37-25(2,3)4)21(30)26-19(16-10-8-7-9-11-16)22(31)28-13-12-18-20(28)17(23(32)33)14-29(18)38(6,35)36/h15-20,24,34H,7-14H2,1-6H3,(H,26,30)(H,32,33) |
| InChIKey | HRBZIDZQGWBHDK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 156.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|